<- User:Beetstra/listing14 - User:Beetstra/Validation - User:Beetstra/listing16 ->

Data

3501 to 3550

Denaverine (3502)
```
Botcommand: addindex 356384370 Denaverine
```
```
For index : Denaverine=356384370
```
* 3579-62-2 -> 3579-62-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Denaverine not found on commonchemistry - Denaverine

* No ChemSpiderID

* PubChem: 71130

* No InChI

* No SMILES
Denileukin_diftitox (3503)
* No CASNo

* Denileukin+diftitox not found on commonchemistry - Denileukin+diftitox

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Denopamine (3504)
```
Botcommand: addindex 360224695 Denopamine
```
```
For index : Denopamine=360224695
```
* 71771-90-9 -> 71771-90-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Denopamine not found on commonchemistry - Denopamine

* ChemSpiderID: 64795 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 71754

* No InChI - (ChemSpider: | InChI=InChI=1/C18H23NO4/c1-22-17-8-3-13(11-18(17)23-2)9-10-19-12-16(21)14-4-6-15(20)7-5-14/h3-8,11,16,19-21H,9-10,12H2,1-2H3/t16-/m1/s1 )

* No SMILES - (ChemSpider: | smiles=O(c1ccc(cc1OC)CCNC[C@@H](O)c2ccc(O)cc2)C )
Denosumab (3505)
```
Botcommand: addindex 345948657 Denosumab
```
```
For index : Denosumab=345948657
```
* 615258-40-7 -> 615258-40-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Denosumab not found on commonchemistry - Denosumab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Deoxyadenosine_diphosphate (3507)
```
Botcommand: addindex 354330221 Deoxyadenosine_diphosphate
```
```
For index : Deoxyadenosine_diphosphate=354330221
```
* 2793-06-8 -> 2793-06-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Deoxyadenosine+diphosphate not found on commonchemistry - Deoxyadenosine+diphosphate

* No ChemSpiderID

* PubChem: 620

* No InChI

* SMILES: C1C(C(OC1N2C=NC3=C2N=CN=C3N) COP(=O)(O)OP(=O)(O)O)O
Deoxycytidine_diphosphate (3512)
```
Botcommand: addindex 324672298 Deoxycytidine_diphosphate
```
```
For index : Deoxycytidine_diphosphate=324672298
```
* 800-73-7 -> 800-73-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Deoxycytidine+diphosphate not found on commonchemistry - Deoxycytidine+diphosphate

* No ChemSpiderID

* PubChem: 3972

* No InChI

* SMILES: Nc1ccn(C2CC(O)C(COP(=O)(O)OP(=O)(O)O)O2)c(=O)n1
Deoxycytidine_triphosphate (3514)

* No CASNo

* Deoxycytidine+triphosphate found on commonchemistry - Deoxycytidine+triphosphate
* 2056-98-6 (exact match)
Name in list

All names: 2'-DeoxyCTP, 2'-Deoxycytidine 5'-triphosphate, 5'-DCTP, citidina 5'-(tetrahidrogeno trifosfato), 2'-desoxi-, Cytidin-5'-(tetrahydrogen-triphosphat), 2'-Deoxy-, Cytidine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, cytidine, (triphosphate tetra-acide)-5', desoxy-2', Cytidine, 2'-deoxy-, 5'-(tetrahydrogen triphosphate), Cytidine, 2'-deoxy-, triphosphate, dCTP, Deoxy-5'-CTP, Deoxy-CTP, Deoxycytidine 5'-triphosphate, [[deoxycytidine triphosphate]]

* No ChemSpiderID

* PubChem: 65091

* No InChI

* SMILES: C1C(C(OC1N2C=CC(=NC2=O)N) COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Deoxyepinephrine (3515)
```
Botcommand: addindex 349766022 Deoxyepinephrine
```
```
For index : Deoxyepinephrine=349766022
```
* 501-15-5 -> 501-15-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Deoxyepinephrine not found on commonchemistry - Deoxyepinephrine

* ChemSpiderID: 4229 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 4382

* InChI: 1/C9H13NO2/c1-10-5-4-7-2-3-8(11)9(12)6-7/h2-3,6,10-12H,4-5H2,1H3 - (ChemSpider: | InChI=InChI=1/C9H13NO2/c1-10-5-4-7-2-3-8(11)9(12)6-7/h2-3,6,10-12H,4-5H2,1H3 )

* SMILES: Oc1ccc(cc1O)CCNC - (ChemSpider: | SMILES=Oc1ccc(cc1O)CCNC )
Deoxyguanosine_diphosphate (3517)

* No CASNo

* Deoxyguanosine+diphosphate not found on commonchemistry - Deoxyguanosine+diphosphate

* No ChemSpiderID

* PubChem: 644

* No InChI

* SMILES: C1C(C(OC1N2C=NC3=C2NC (=NC3=O)N)COP(=O)(O)OP(=O)(O)O)O
Deoxyguanosine_triphosphate (3519)

* No CASNo

* Deoxyguanosine+triphosphate found on commonchemistry - Deoxyguanosine+triphosphate
* 2564-35-4 (exact match)
Name in list

All names: 2'-Deoxy-5'-GTP, 2'-deoxyguanosine 5'-(tetrahydrogen triphosphate), 2'-deoxyguanosine 5'-(tetrahydrogen triphosphate), 2'-Deoxyguanosine 5'-triphosphate, 2'-Desoxyguanosin-5'-(tetrahydrogentriphosphat), 5'-(tetrahidrogenotrifosfato) de 2'-desoxiguanosina, 5'-(tetrahydrogenotriphosphate) de 2'-desoxyguanosine, 5'-DGTP, Deoxy-GTP, Deoxyguanosine 5'-triphosphate, [[deoxyguanosine triphosphate]], dGTP, Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, Guanosine, 2'-deoxy-, 5'-(tetrahydrogen triphosphate), Guanosine, 2'-deoxy-, 5'-triphosphate

* No ChemSpiderID

* PubChem: 65103

* No InChI

* SMILES: C1C(C(OC1N2C=NC3=C2NC(=NC3=O)N) COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Deoxythymidine_monophosphate (3521)
```
Botcommand: addindex 265759340 Deoxythymidine_monophosphate
```
```
For index : Deoxythymidine_monophosphate=265759340
```
* 365-07-1 -> 365-07-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Deoxythymidine+monophosphate not found on commonchemistry - Deoxythymidine+monophosphate

* No ChemSpiderID

* PubChem: 1139

* No InChI

* No SMILES
Deoxyuridine_monophosphate (3523)
```
Botcommand: addindex 332721776 Deoxyuridine_monophosphate
```
```
For index : Deoxyuridine_monophosphate=332721776
```
* 964-26-1 -> 964-26-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Deoxyuridine+monophosphate not found on commonchemistry - Deoxyuridine+monophosphate

* No ChemSpiderID

* PubChem: 688

* No InChI

* No SMILES
Deptropine (3524)
```
Botcommand: addindex 346279020 Deptropine
```
```
For index : Deptropine=346279020
```
* 604-51-3 -> 604-51-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Deptropine not found on commonchemistry - Deptropine

* ChemSpiderID: 16735768 (correct: 16735768) - CORRECT - Retrieved data from ChemSpider

* PubChem: 16576

* No InChI - (ChemSpider: | InChI=InChI=1/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+ )

* No SMILES - (ChemSpider: | smiles=CN5[C@@H]1CC[C@H]5C[C@H](C1)OC3c4ccccc4CCc2ccccc23 )
Dequalinium (3525)

* No CASNo

* Dequalinium not found on commonchemistry - Dequalinium

* No ChemSpiderID (correct: 2886)

* PubChem: 10649

* No InChI

* No SMILES
Deracoxib (3526)
```
Botcommand: addindex 357430992 Deracoxib
```
```
For index : Deracoxib=357430992
```
* 169590-41-4 -> 169590-41-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Deracoxib not found on commonchemistry - Deracoxib

* No ChemSpiderID

* PubChem: 3058754

* No InChI

* No SMILES
Deramciclane (3527)
```
Botcommand: addindex 348505265 Deramciclane
```
```
For index : Deramciclane=348505265
```
* 120444-72-6 -> 120444-72-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Deramciclane not found on commonchemistry - Deramciclane

* No ChemSpiderID

* PubChem: 119590

* No InChI

* No SMILES
Dermatan_sulfate (3528)
```
Botcommand: addindex 303310170 Dermatan_sulfate
```
```
For index : Dermatan_sulfate=303310170
```
* 24967-94-0 -> 24967-94-0 - NOT VERIFIED

* CAS found on commonchemistry - 24967-94-0 - name in list
All names: Chondroitin sulfate B, Chondroitin sulfate type B, chondroitine, (sulfate acide)-4, B, Chondroitinsulfuric acid B, Chondroitinsulfuric acid type B, Chondroitinsulfuric acid, type B, Chondroitinsulfuric acids, type B, Dermatan 4-sulfate, Dermatan hydrogen sulfate, Dermatan polysulfate, Dermatan sulfate, Dermatan sulphate, dermatan, 4-(hidrogeno sulfato), Dermatan, 4-(hydrogen sulfate), Dermatan, 4-(Hydrogensulfat), Dermatan, hydrogen sulfate (ester), Desmin 370, DS 435, DS 435 (polysaccharide), MF 701, MF 701 (polysaccharide), Î²-Heparin

* Dermatan+sulfate found on commonchemistry - Dermatan+sulfate
* 24967-94-0 (exact match) Matches CAS (24967-94-0) on page
Name in list

All names: Chondroitin sulfate B, Chondroitin sulfate type B, chondroitine, (sulfate acide)-4, B, Chondroitinsulfuric acid B, Chondroitinsulfuric acid type B, Chondroitinsulfuric acid, type B, Chondroitinsulfuric acids, type B, Dermatan 4-sulfate, Dermatan hydrogen sulfate, Dermatan polysulfate, [[dermatan sulfate]], Dermatan sulphate, dermatan, 4-(hidrogeno sulfato), Dermatan, 4-(hydrogen sulfate), Dermatan, 4-(Hydrogensulfat), Dermatan, hydrogen sulfate (ester), Desmin 370, DS 435, DS 435 (polysaccharide), MF 701, MF 701 (polysaccharide), Î²-Heparin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Derrubone (3529)

* No CASNo

* Derrubone not found on commonchemistry - Derrubone

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Desaspidin (3530)
```
Botcommand: addindex 346842157 Desaspidin
```
```
For index : Desaspidin=346842157
```
* 114-43-2 -> 114-43-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Desaspidin not found on commonchemistry - Desaspidin

* No ChemSpiderID

* PubChem: 8238

* No InChI

* No SMILES
Desformylflustrabromine (3533)

* No CASNo

* Desformylflustrabromine not found on commonchemistry - Desformylflustrabromine

* No ChemSpiderID

* PubChem: 637026

* No InChI

* No SMILES
Desiccated_thyroid_extract (3534)
* No CASNo

* Desiccated+thyroid+extract not found on commonchemistry - Desiccated+thyroid+extract

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Deslorelin (3538)
* No CASNo

* Deslorelin not found on commonchemistry - Deslorelin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Desmethoxyyangonin (3539)
```
Botcommand: addindex 354955628 Desmethoxyyangonin
```
```
For index : Desmethoxyyangonin=354955628
```
* 1952-41-6 -> 1952-41-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Desmethoxyyangonin not found on commonchemistry - Desmethoxyyangonin

* No ChemSpiderID

* PubChem: 5273621

* No InChI

* SMILES: COC1=CC(=O)OC(=C1)C=CC2=CC=CC=C2
Desmethylcitalopram (3540)
```
Botcommand: addindex 344800091 Desmethylcitalopram
```
```
For index : Desmethylcitalopram=344800091
```
* 144010-85-5 -> 144010-85-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Desmethylcitalopram not found on commonchemistry - Desmethylcitalopram

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Desmethylclozapine (3541)
```
Botcommand: addindex 359717202 Desmethylclozapine
```
```
For index : Desmethylclozapine=359717202
```
* 6104-71-8 -> 6104-71-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Desmethylclozapine not found on commonchemistry - Desmethylclozapine

* ChemSpiderID: 14126465 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2820

* No InChI - (ChemSpider: | InChI=InChI=1/C17H17ClN4/c18-12-5-6-15-16(11-12)21-17(22-9-7-19-8-10-22)13-3-1-2-4-14(13)20-15/h1-6,11,19-20H,7-10H2 )

* No SMILES - (ChemSpider: | smiles=Clc1ccc2Nc4ccccc4C(=N\c2c1)/N3CCNCC3 )
Desmethylsertraline (3542)
```
Botcommand: addindex 352318066 Desmethylsertraline
```
```
For index : Desmethylsertraline=352318066
```
* 87857-41-8  ->  87857-41-8  - NOT VERIFIED

* The CAS number '87857-41-8 ' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Desmethylsertraline not found on commonchemistry - Desmethylsertraline

* ChemSpiderID: 102729 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 114743

* No InChI - (ChemSpider: | InChI=InChI=1/C16H15Cl2N/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13/h1-5,7,9,11,16H,6,8,19H2/t11-,16-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=Clc1ccc(cc1Cl)[C@H]3c2c(cccc2)[C@@H](N)CC3 )
Desmopressin (3543)
```
Botcommand: addindex 362221280 Desmopressin
```
```
For index : Desmopressin=362221280
```
* 16679-58-6 -> 16679-58-6 - NOT VERIFIED

* CAS found on commonchemistry - 16679-58-6 - name in list
All names: (1-Deamino-8-D-Arg)-vasopressin, [[[1-Î²-Mercaptopropionic acid-8-D-arginine]vasopressin]], [[[Deamino1-D-arginine8]vasopressin]], [[[Desamino-Cys1,D-Arg8]vasopressin]], 1-(3-Mercaptopropionic acid)-8-D-arginine-vasopressin, 1: PN: US20020013262 PAGE: 2 claimed protein, [[1-Deamino-[8-D-arginine]vasopressin]], [[1-Deamino-1-[D-Arg8]-vasopressin]], 1-Desamino-8-D-arginine-vasopressin, 1-Desaminocystine-8-D-arginine-vasopressin, 45: PN: WO2005000360 SEQID: 40 claimed protein, 8-D-Arginine deaminovasopressin, Adiuretin, Adiuretin SD, DAV Ritter, DDAVP, desmopresina, desmopressin, desmopressine, Desmospray, Glycinamide, N-(3-mercapto-1-oxopropyl)-L-tyrosyl-L-phenylalanyl-L-glutaminyl-L-asparaginyl-L-cysteinyl-L-prolyl-D-arginyl-, cyclic (1â†’5)-disulfide, Minirin, Minrin, Peptide, (Xaa-Tyr-Phe-Gln-Asn-Cys-Pro-Arg-Gly), ?, Vasopressin, 1-(3-mercaptopropanoic acid)-8-D-arginine-, Vasopressin, 1-(3-mercaptopropionic acid)-8-D-arginine-

* Desmopressin found on commonchemistry - Desmopressin
* 16679-58-6 (exact match) Matches CAS (16679-58-6) on page
Name in list

All names: (1-Deamino-8-D-Arg)-vasopressin, [[[1-Î²-Mercaptopropionic acid-8-D-arginine]vasopressin]], [[[Deamino1-D-arginine8]vasopressin]], [[[Desamino-Cys1,D-Arg8]vasopressin]], 1-(3-Mercaptopropionic acid)-8-D-arginine-vasopressin, 1: PN: US20020013262 PAGE: 2 claimed protein, [[1-Deamino-[8-D-arginine]vasopressin]], [[1-Deamino-1-[D-Arg8]-vasopressin]], 1-Desamino-8-D-arginine-vasopressin, 1-Desaminocystine-8-D-arginine-vasopressin, 45: PN: WO2005000360 SEQID: 40 claimed protein, 8-D-Arginine deaminovasopressin, Adiuretin, Adiuretin SD, DAV Ritter, DDAVP, desmopresina, [[desmopressin]], [[desmopressine]], Desmospray, Glycinamide, N-(3-mercapto-1-oxopropyl)-L-tyrosyl-L-phenylalanyl-L-glutaminyl-L-asparaginyl-L-cysteinyl-L-prolyl-D-arginyl-, cyclic (1â†’5)-disulfide, Minirin, Minrin, Peptide, (Xaa-Tyr-Phe-Gln-Asn-Cys-Pro-Arg-Gly), ?, Vasopressin, 1-(3-mercaptopropanoic acid)-8-D-arginine-, Vasopressin, 1-(3-mercaptopropionic acid)-8-D-arginine-

* ChemSpiderID: 10481973 (correct: 10481973) - CORRECT - Retrieved data from ChemSpider

* PubChem: 5311065

* No InChI - (ChemSpider: | InChI=InChI=1/C46H64N14O12S2/c47-35(62)15-14-29-40(67)58-32(22-36(48)63)43(70)59-33(45(72)60-18-5-9-34(60)44(71)56-28(8-4-17-52-46(50)51)39(66)53-23-37(49)64)24-74-73-19-16-38(65)54-30(21-26-10-12-27(61)13-11-26)41(68)57-31(42(69)55-29)20-25-6-2-1-3-7-25/h1-3,6-7,10-13,28-34,61H,4-5,8-9,14-24H2,(H2,47,62)(H2,48,63)(H2,49,64)(H,53,66)(H,54,65)(H,55,69)(H,56,71)(H,57,68)(H,58,67)(H,59,70)(H4,50,51,52)/t28-,29-,30-,31-,32-,33-,34-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=NC(=O)CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]4CSSCCC(=O)N[C@@H](Cc2ccc(O)cc2)C(=O)N[C@@H](Cc3ccccc3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N4 )
Desmosine (3544)
```
Botcommand: addindex 326956804 Desmosine
```
```
For index : Desmosine=326956804
```
* 11003-57-9 -> 11003-57-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Desmosine not found on commonchemistry - Desmosine

* No ChemSpiderID

* PubChem: 25435

* No InChI

* No SMILES
Desomorphine (3547)
```
Botcommand: addindex 360418416 Desomorphine
```
```
For index : Desomorphine=360418416
```
* 427-00-9 -> 427-00-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Desomorphine not found on commonchemistry - Desomorphine

* ChemSpiderID: 4515044 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 5362456

* No InChI - (ChemSpider: | InChI=InChI=1/C17H21NO2/c1-18-8-7-17-11-3-2-4-14(17)20-16-13(19)6-5-10(15(16)17)9-12(11)18/h5-6,11-12,14,19H,2-4,7-9H2,1H3/t11-,12+,14-,17+/m0/s1 )

* No SMILES - (ChemSpider: | smiles=Oc2c1O[C@@H]5[C@@]34c1c(cc2)C[C@@H](N(CC3)C)[C@@H]4CCC5 )
Desosamine (3549)
```
Botcommand: addindex 346852147 Desosamine
```
```
For index : Desosamine=346852147
```
* 5779-39-5 -> 5779-39-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Desosamine not found on commonchemistry - Desosamine

* ChemSpiderID: 147813 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 168997

* InChI: 1/C8H17NO3/c1-6(11)4-7(9(2)3)8(12)5-10/h5-8,11-12H,4H2,1-3H3/t6-,7+,8+/m1/s1 - (ChemSpider: | InChI=InChI=1/C8H17NO3/c1-6(11)4-7(9(2)3)8(12)5-10/h5-8,11-12H,4H2,1-3H3/t6-,7+,8+/m1/s1 )

* SMILES: O=C[C@H](O)[C@@H](N(C)C)C[C@H](O)C - (ChemSpider: | SMILES=O=C[C@H](O)[C@@H](N(C)C)C[C@H](O)C )

3551 to 3600

Desoxyfructo-serotonin (3551)
```
Botcommand: addindex 360134591 Desoxyfructo-serotonin
```
```
For index : Desoxyfructo-serotonin=360134591
```
* 57003-86-8 -> 57003-86-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Desoxyfructo+serotonin not found on commonchemistry - Desoxyfructo+serotonin

* No ChemSpiderID

* PubChem: 21120559

* No InChI

* SMILES: C1=CC2=C(C=C1O)C(=CN2)CCNCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O
Desoxymethyltestosterone (3552)
```
Botcommand: addindex 351054384 Desoxymethyltestosterone
```
```
For index : Desoxymethyltestosterone=351054384
```
* 3275-64-7 -> 3275-64-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Desoxymethyltestosterone not found on commonchemistry - Desoxymethyltestosterone

* No ChemSpiderID (correct: 17611)

* PubChem: 18651

* No InChI

* No SMILES
Desoxypipradrol (3553)
```
Botcommand: addindex 359551334 Desoxypipradrol
```
```
For index : Desoxypipradrol=359551334
```
* 519-74-4, -> 519-74-4, - NOT VERIFIED

* The CAS number '519-74-4,' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Desoxypipradrol not found on commonchemistry - Desoxypipradrol

* ChemSpiderID: 141045 (correct: 141045) - CORRECT - Retrieved data from ChemSpider

* PubChem: 160506

* No InChI - (ChemSpider: | InChI=InChI=1/C18H21N/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17/h1-6,9-12,17-19H,7-8,13-14H2 )

* No SMILES - (ChemSpider: | smiles=c1c(cccc1)C(c2ccccc2)C3NCCCC3 )
Desvenlafaxine (3555)
```
Botcommand: addindex 363490043 Desvenlafaxine
```
```
For index : Desvenlafaxine=363490043
```
* 93413-62-8 -> 93413-62-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Desvenlafaxine not found on commonchemistry - Desvenlafaxine

* No ChemSpiderID

* PubChem: 125017

* No InChI

* No SMILES
Detomidine (3556)
```
Botcommand: addindex 348711391 Detomidine
```
```
For index : Detomidine=348711391
```
* 86347-15-1 -> 86347-15-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Detomidine not found on commonchemistry - Detomidine

* ChemSpiderID: 50586 (correct: 50586) - CORRECT - Retrieved data from ChemSpider

* PubChem: 56032

* No InChI - (ChemSpider: | InChI=InChI=1/C12H14N2/c1-9-4-3-5-11(10(9)2)6-12-7-13-8-14-12/h3-5,7-8H,6H2,1-2H3,(H,13,14) )

* No SMILES - (ChemSpider: | smiles=n1cc(nc1)Cc2c(c(ccc2)C)C )
Detumomab (3557)
```
Botcommand: addindex 349778759 Detumomab
```
```
For index : Detumomab=349778759
```
* 145832-33-3 -> 145832-33-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Detumomab not found on commonchemistry - Detumomab

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Deuterated_DMF (3558)
```
Botcommand: addindex 353517914 Deuterated_DMF
```
```
For index : Deuterated_DMF=353517914
```
* 4472-41-7 -> 4472-41-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Deuterated+DMF not found on commonchemistry - Deuterated+DMF

* No ChemSpiderID

* PubChem: 78225

* No InChI

* No SMILES
Deuterated_DMSO (3559)
```
Botcommand: addindex 353517015 Deuterated_DMSO
```
```
For index : Deuterated_DMSO=353517015
```
* 2206-27-1 -> 2206-27-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Deuterated+DMSO not found on commonchemistry - Deuterated+DMSO

* No ChemSpiderID

* PubChem: 75151

* No InChI

* No SMILES
Devapamil (3561)
```
Botcommand: addindex 348527822 Devapamil
```
```
For index : Devapamil=348527822
```
* 92302-55-1 -> 92302-55-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Devapamil not found on commonchemistry - Devapamil

* ChemSpiderID: 59244 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 65832

* InChI: 1/C26H36N2O3/c1-20(2)26(19-27,22-11-12-24(30-5)25(18-22)31-6)14-8-15-28(3)16-13-21-9-7-10-23(17-21)29-4/h7,9-12,17-18,20H,8,13-16H2,1-6H3 - (ChemSpider: | InChI=InChI=1/C26H36N2O3/c1-20(2)26(19-27,22-11-12-24(30-5)25(18-22)31-6)14-8-15-28(3)16-13-21-9-7-10-23(17-21)29-4/h7,9-12,17-18,20H,8,13-16H2,1-6H3 )

* SMILES: N#CC(c1cc(OC)c(OC)cc1)(CCCN(CCc2cccc(OC)c2)C)C(C)C - (ChemSpider: | SMILES=N#CC(c1cc(OC)c(OC)cc1)(CCCN(CCc2cccc(OC)c2)C)C(C)C )
Devazepide (3562)
```
Botcommand: addindex 364180295 Devazepide
```
```
For index : Devazepide=364180295
```
* 103420-77-5 -> 103420-77-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Devazepide not found on commonchemistry - Devazepide

* No ChemSpiderID

* PubChem: 59751

* No InChI

* No SMILES
Dewar_benzene (3563)
* No CASNo

* Dewar+benzene not found on commonchemistry - Dewar+benzene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dexamethasone_isonicotinate (3565)
```
Botcommand: addindex 356552641 Dexamethasone_isonicotinate
```
```
For index : Dexamethasone_isonicotinate=356552641
```
* 2265-64-7 -> 2265-64-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexamethasone+isonicotinate not found on commonchemistry - Dexamethasone+isonicotinate

* ChemSpiderID: 15881 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 16752

* InChI: 1/C28H32FNO6/c1-16-12-21-20-5-4-18-13-19(31)6-9-25(18,2)27(20,29)22(32)14-26(21,3)28(16,35)23(33)15-36-24(34)17-7-10-30-11-8-17/h6-11,13,16,20-22,32,35H,4-5,12,14-15H2,1-3H3/t16-,20+,21+,22+,25+,26+,27+,28+/m1/s1 - (ChemSpider: | InChI=InChI=1/C28H32FNO6/c1-16-12-21-20-5-4-18-13-19(31)6-9-25(18,2)27(20,29)22(32)14-26(21,3)28(16,35)23(33)15-36-24(34)17-7-10-30-11-8-17/h6-11,13,16,20-22,32,35H,4-5,12,14-15H2,1-3H3/t16-,20+,21+,22+,25+,26+,27+,28+/m1/s1 )

* SMILES: O=C(OCC(=O)[C@@]3(O)[C@H](C)C[C@H]2[C@@H]4CCC\1=C\C(=O)\C=C/[C@]/1(C)[C@@]4(F)[C@@H](O)C[C@@]23C)c5ccncc5 - (ChemSpider: | SMILES=O=C(OCC(=O)[C@@]3(O)[C@H](C)C[C@H]2[C@@H]4CCC\1=C\C(=O)\C=C/[C@]/1(C)[C@@]4(F)[C@@H](O)C[C@@]23C)c5ccncc5 )
Dexanabinol (3566)
```
Botcommand: addindex 349390541 Dexanabinol
```
```
For index : Dexanabinol=349390541
```
* 112924-45-5 -> 112924-45-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexanabinol not found on commonchemistry - Dexanabinol

* No ChemSpiderID

* PubChem: 107778

* No InChI

* No SMILES
Dexchlorpheniramine (3568)
```
Botcommand: addindex 349389811 Dexchlorpheniramine
```
```
For index : Dexchlorpheniramine=349389811
```
* 25523-97-1 -> 25523-97-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexchlorpheniramine not found on commonchemistry - Dexchlorpheniramine

* ChemSpiderID: 30576 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 33036

* No InChI - (ChemSpider: | InChI=InChI=1/C16H19ClN2/c1-19(2)12-10-15(16-5-3-4-11-18-16)13-6-8-14(17)9-7-13/h3-9,11,15H,10,12H2,1-2H3/t15-/m0/s1 )

* No SMILES - (ChemSpider: | smiles=Clc1ccc(cc1)[C@@H](c2ncccc2)CCN(C)C )
Dexelvucitabine (3569)
```
Botcommand: addindex 349389859 Dexelvucitabine
```
```
For index : Dexelvucitabine=349389859
```
* 134379-77-4 -> 134379-77-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexelvucitabine not found on commonchemistry - Dexelvucitabine

* No ChemSpiderID

* PubChem: 64973

* No InChI

* SMILES: C1=CC(OC1CO)N2C=C(C(=NC2=O)N)F
Dexetimide (3570)
```
Botcommand: addindex 352891084 Dexetimide
```
```
For index : Dexetimide=352891084
```
* 21888-98-2 -> 21888-98-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexetimide not found on commonchemistry - Dexetimide

* ChemSpiderID: 20533 (correct: 28615) - INCORRECT

* PubChem: 21847

* No InChI

* No SMILES
Dexketoprofen (3573)

* No CASNo

* Dexketoprofen not found on commonchemistry - Dexketoprofen

* No ChemSpiderID

* PubChem: 667550

* No InChI

* No SMILES
Dexlansoprazole (3574)
```
Botcommand: addindex 354507178 Dexlansoprazole
```
```
For index : Dexlansoprazole=354507178
```
* 138530-94-6 -> 138530-94-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexlansoprazole not found on commonchemistry - Dexlansoprazole

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dexloxiglumide (3575)
```
Botcommand: addindex 360226032 Dexloxiglumide
```
```
For index : Dexloxiglumide=360226032
```
* 119817-90-2 -> 119817-90-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexloxiglumide not found on commonchemistry - Dexloxiglumide

* No ChemSpiderID

* PubChem: 65937

* No InChI

* No SMILES
Dexmethylphenidate (3577)
```
Botcommand: addindex 362704674 Dexmethylphenidate
```
```
For index : Dexmethylphenidate=362704674
```
* 40431-64-9 -> 40431-64-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexmethylphenidate not found on commonchemistry - Dexmethylphenidate

* No ChemSpiderID (correct: 135807)

* PubChem: 4158

* No InChI

* No SMILES
Dexoxadrol (3578)
```
Botcommand: addindex 350291053 Dexoxadrol
```
```
For index : Dexoxadrol=350291053
```
* 6495-46-1 -> 6495-46-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dexoxadrol not found on commonchemistry - Dexoxadrol

* No ChemSpiderID

* PubChem: 3034023

* No InChI

* No SMILES
Dextrallorphan (3580)
```
Botcommand: addindex 356730759 Dextrallorphan
```
```
For index : Dextrallorphan=356730759
```
* 5822-43-5 -> 5822-43-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dextrallorphan not found on commonchemistry - Dextrallorphan

* ChemSpiderID: 2339009 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 3081395

* No InChI - (ChemSpider: | InChI=InChI=1/C19H25NO/c1-2-10-20-11-9-19-8-4-3-5-16(19)18(20)12-14-6-7-15(21)13-17(14)19/h2,6-7,13,16,18,21H,1,3-5,8-12H2/t16-,18+,19-/m1/s1 )

* No SMILES - (ChemSpider: | smiles=Oc1ccc3c(c1)[C@]24[C@@H]([C@H](N(CC2)C\C=C)C3)CCCC4 )
Dextran (3581)
```
Botcommand: addindex 347678163 Dextran
```
```
For index : Dextran=347678163
```
* 9004-54-0 -> 9004-54-0 - NOT VERIFIED

* CAS found on commonchemistry - 9004-54-0 - name in list
All names: 29: PN: WO2005077412 SEQID: 29 claimed sequence, CDC-H, Detrax 40, DEX 500, Dextran, Dextran 1.5, Dextran 10, Dextran 1000, Dextran 10000, Dextran 110, Dextran 15, Dextran 150, Dextran 2000, Dextran 20000, Dextran 250, Dextran 3000, Dextran 40, Dextran 40000, Dextran 45, Dextran 500, Dextran 60, Dextran 70, Dextran 75, Dextran B 512, Dextran B1355, Dextran D 10, Dextran PL 1S, Dextran PT 25, Dextran PVD, Dextran RMI, Dextran T 10, Dextran T 100, Dextran T 110, Dextran T 150, Dextran T 20, Dextran T 2000, Dextran T 40, Dextran T 500, Dextran T 70, Dextranen, dextrano, Dextrans, Dextraven, Eudextran, Expandex, G 75, Gentran, Gentran 40, Hemodex, Hyscon, Hyskon, Infucoll, Intrader, Intradex, LMD, LMWD, Longasteril 70, LU 122, LVD, Macrodex, Macrose, Oncovertin N, Onkotin, PL 1S, Plasmafusin, Plasmodex, Plavolex, Polyglucin, Polyglusol, Promit, Rheodextran, Rheoisodex, Rheomacrodex, Rheopolyglucin, Rheopolyglucine, Rheorondex, Rheotran, Rondex, Rondex (polysaccharide), Serva G, T 10, T 10 (carbohydrate), T 110, T 110 (carbohydrate), T 150, T 20, T 20 (carbohydrate), T 250, T 250 (polysaccharide), T 4, T 4 (polysaccharide), T 40, T 40 (polysaccharide), T 5, T 5 (polysaccharide), T 500, T 500 (carbohydrate), T 6, T 70, T 70 (carbohydrate), Ultradex, Î±-Dextran

* Dextran found on commonchemistry - Dextran
* 9004-54-0 (Formula: W99; Name: Dextran) Matches CAS (9004-54-0) on page

* 9004-66-4 (Formula: Unspecified; Name: Iron dextran)

* 9025-70-1 (Formula: Unspecified; Name: Dextranase)

* 9042-14-2 (Formula: H2O4S.xW99; Name: Dextran, hydrogen sulfate)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dextranomer (3582)
* No CASNo

* Dextranomer not found on commonchemistry - Dextranomer

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dextrin (3583)
```
Botcommand: addindex 363069000 Dextrin
```
```
For index : Dextrin=363069000
```
* 9004-53-9 -> 9004-53-9 - NOT VERIFIED

* CAS found on commonchemistry - 9004-53-9 - name in list
All names: 102D, 102K, 1752S, 30AN, 37LAC19, 955SR, Amaizo 1706, Amaizo 1752S, Amicol 7H, Amycol 1, Amycol 10, Amycol 6L, Aquaflake 31, Arabix 6, Arabix 7, Avedex 35, Avedex 58MD14, Avedex 58MD14C, Avedex W 15, Avedex W 90, Bindex 2, BLD, BLD 8, British gum, British gum APA, C 23, C 23 (polysaccharide), C*DrySet, C*Film TCF 07311, C*Plus 07380, Canary S 8032, Corn dextrin, CPC 8071, Cream Dextrin 15, Crystal Gum, Crystal Tex 627, CZRM X, D 3100, D 3100 (gum), D 400E, Dextrid, Dextrin, Dextrin 10, Dextrin 101, Dextrin 102N, Dextrin 102S, Dextrin 1104, Dextrin 12, Dextrin 1719, Dextrin 20, Dextrin 3, Dextrin ND-S, Dextrin ND-SN, dextrina, Dextrina Bianca, Dextrine, DEXTRINE POWDER, WHITE, Dextrins, Dexy 84, Dexy 85, Dexy 86, DF 2600, Eclipse G, EDW 90, Electrocol 70, Emdex 30An45, Emdex White, Farinex CO 2, Farinex MJ, Fibersol 2, Fortodex, FSD 103, FSD 610, Fungal amylase starch, Globe 8051, Gommelin, GOS-sugar, Gumstar B, H-Fibre, Hidex 106, Hidex 128, Hidex 208, Hidex 50, Hi-Set CHG, Hydrolysed dextrin, Inadpul DE 12, K 4484, Kokumigen, Koldex 60, Kuriimu Dextrin, Kuriimu Dextrin 3, Leiocom, Licopol, Ligament BAE 4, Ligament P 950A, LSPD, Lycatab DSH, M 250, M 365, M 550, M 600, Max 1000, MF 30, MF 30 (dextrin), Microcrystalline cellulose, MW 2280, Nadex 320, Nadex 442, ND-S, Noredux 200E, Noredux C 15, Noredux C 558, NSD-C, Nutriose, Nutriose FB, Nutriose FB 06, Oji Ace P 400, PenCling 720B, Perfectamyl B 1102, Pinedex, Pinedex 1, Pinedex 100, Pinedex 3, Pinedex 6, Pinefibre, Pinefibre C, Pinefibre U, Pineflow KH, Pinflow KH, Potato dextrin, Primogran W, Printex S, Pyrodextrin, Red Ball Dextrin, Red Ball Dextrin 102S, S 102, Sandec 100, Sandec 150, Sandec 30, Sandec 70, SPD, SPD (polysaccharide), SR 25, SR 25 (polysaccharide), SR 7, SR 7 (polysaccharide), Stacodex, Stadex 105, Stadex 125, Stadex 126, Stadex 128, Stadex 132, Stadex 201, Stadex 230, Stadex 82, Stadex 90, Staleydex 3370, Staleydex 95, Starch gum, Starch, dextrinized, Starch, thin-boiling, Stuccodex, Stydex 074303, Superior 40, Superior S, Swift 37192, Tackidex 035, Tackidex 050, Tackidex 133, Tackidex C 172, Tackidex DF 165, Tackidex G 155, Tackidex G 170, Tackidex J 55K, Tackidex JO 60K, Tapioca dextrin, TCF 07311, Ultra/Set LT, W 50, W 50 (gum)

* Dextrin found on commonchemistry - Dextrin
* 9004-53-9 (Formula: Unspecified; Name: Dextrin) Matches CAS (9004-53-9) on page

* 7585-39-9 (Formula: C42H70O35; Name: Î²-Cyclodextrin)

* 9001-06-3 (Formula: Unspecified; Name: Chitinase)

* 9012-54-8 (Formula: Unspecified; Name: Cellulase)

* 9030-09-5 (Formula: Unspecified; Name: Glycosyltransferase, cyclodextrin)

* 9035-74-9 (Formula: Unspecified; Name: Phosphorylase, glycogen)

* 9050-36-6 (Formula: W99; Name: Maltodextrin)

* 9075-68-7 (Formula: Unspecified; Name: Pullulanase)

* 10016-20-3 (Formula: C36H60O30; Name: Î±-Cyclodextrin)

* 12619-70-4 (Formula: W99; Name: Cyclodextrin)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dextromoramide (3586)
```
Botcommand: addindex 363640254 Dextromoramide
```
```
For index : Dextromoramide=363640254
```
* 357-56-2 -> 357-56-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dextromoramide not found on commonchemistry - Dextromoramide

* No ChemSpiderID (correct: 83901)

* PubChem: 92943

* No InChI

* No SMILES
Dextrorphan (3588)
```
Botcommand: addindex 359785519 Dextrorphan
```
```
For index : Dextrorphan=359785519
```
* 125-73-5 -> 125-73-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Dextrorphan not found on commonchemistry - Dextrorphan

* No ChemSpiderID

* PubChem: 5360697

* No InChI

* No SMILES
Dezocine (3589)
```
Botcommand: addindex 358670569 Dezocine
```
```
For index : Dezocine=358670569
```
* 53648-55-8 -> 53648-55-8 - NOT VERIFIED

* CAS found on commonchemistry - 53648-55-8 - name not in list
All names: 5,11-Methanobenzocyclodecen-3-ol, 13-amino-5,6,7,8,9,10,11,12-octahydro-5-methyl-, (5R,11S,13S)-

* Dezocine not found on commonchemistry - Dezocine

* No ChemSpiderID (correct: 2297867)

* PubChem: 40841

* No InChI

* No SMILES
Dhurrin (3590)

* No CASNo

* Dhurrin not found on commonchemistry - Dhurrin

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Di-tert-butyl_ether (3592)
```
Botcommand: addindex 356516488 Di-tert-butyl_ether
```
```
For index : Di-tert-butyl_ether=356516488
```
* 6163-66-2 -> 6163-66-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Di+tert+butyl+ether not found on commonchemistry - Di+tert+butyl+ether

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Di-tert-butylzinc (3594)

* No CASNo

* Di+tert+butylzinc not found on commonchemistry - Di+tert+butylzinc

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
DiOC6 (3595)
```
Botcommand: addindex 354963122 DiOC6
```
```
For index : DiOC6=354963122
```
* 53213-82-4 -> 53213-82-4 - NOT VERIFIED

* CAS not found on commonchemistry

* DiOC found on commonchemistry - DiOC
* 51-63-8 (Formula: C9H13N.1/2H2O4S; Name: Benzeneethanamine, Î±-methyl-, (Î±S)-, sulfate (2:1))

* 64-75-5 (Formula: C22H24N2O8.ClH; Name: 2-Naphthacenecarboxamide, 4-(dimethylamino)-1,4,4a,5,5a,6,11,12a-octahydro-3,6,10,12,12a-pentahydroxy-6-methyl-1,11-dioxo-, monohydrochloride, (4S,4aS,5aS,6S,12aS)-)

* 67-73-2 (Formula: C24H30F2O6; Name: Pregna-1,4-diene-3,20-dione, 6,9-difluoro-11,21-dihydroxy-16,17-[(1-methylethylidene)bis(oxy)]-, (6Î±,11Î²,16Î±)-)

* 73-78-9 (Formula: C14H22N2O.ClH; Name: Acetamide, 2-(diethylamino)-N-(2,6-dimethylphenyl)-, monohydrochloride)

* 77-19-0 (Formula: C19H35NO2; Name: [1,1'-Bicyclohexyl]-1-carboxylic acid, 2-(diethylamino)ethyl ester)

* 103-23-1 (Formula: C22H42O4; Name: Hexanedioic acid, bis(2-ethylhexyl) ester)

* 107-64-2 (Formula: C38H80N.Cl; Name: 1-Octadecanaminium, N,N-dimethyl-N-octadecyl-, chloride)

* 117-81-7 (Formula: C24H38O4; Name: 1,2-Benzenedicarboxylic acid, bis(2-ethylhexyl) ester)

* 117-84-0 (Formula: C24H38O4; Name: 1,2-Benzenedicarboxylic acid, dioctyl ester)

* 122-62-3 (Formula: C26H50O4; Name: Decanedioic acid, bis(2-ethylhexyl) ester)

* No ChemSpiderID

* PubChem: 9894321

* No InChI

* SMILES: CCCCCCN\1C2=CC=CC=C2O/C1=C/C=C/C3=[N+](C4=CC=CC=C4O3)CCCCCC.[I-]
Diacerein (3596)
```
Botcommand: addindex 342954638 Diacerein
```
```
For index : Diacerein=342954638
```
* 13739-02-1 -> 13739-02-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Diacerein not found on commonchemistry - Diacerein

* No ChemSpiderID (correct: 24456)

* PubChem: 26248

* No InChI

* No SMILES
Diacetolol (3597)
```
Botcommand: addindex 351953253 Diacetolol
```
```
For index : Diacetolol=351953253
```
* 22568-64-5 -> 22568-64-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Diacetolol not found on commonchemistry - Diacetolol

* ChemSpiderID: 46139 (correct: 46139) - CORRECT - Retrieved data from ChemSpider

* PubChem: 50894

* No InChI - (ChemSpider: | InChI=InChI=1/C16H24N2O4/c1-10(2)17-8-14(21)9-22-16-6-5-13(18-12(4)20)7-15(16)11(3)19/h5-7,10,14,17,21H,8-9H2,1-4H3,(H,18,20) )

* No SMILES - (ChemSpider: | smiles=O=C(Nc1ccc(OCC(O)CNC(C)C)c(c1)C(=O)C)C )
Diacetyldihydromorphine (3600)
```
Botcommand: addindex 360307660 Diacetyldihydromorphine
```
```
For index : Diacetyldihydromorphine=360307660
```
* 509-71-7 -> 509-71-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Diacetyldihydromorphine not found on commonchemistry - Diacetyldihydromorphine

* No ChemSpiderID (correct: 4514291)

* PubChem: 5359460

* No InChI

* No SMILES

3601 to 3650

Diacetylverrucarol (3602)
```
Botcommand: addindex 360073227 Diacetylverrucarol
```
```
For index : Diacetylverrucarol=360073227
```
* 2198-94-9 -> 2198-94-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Diacetylverrucarol not found on commonchemistry - Diacetylverrucarol

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dialdehyde_starch (3603)
```
Botcommand: addindex 357080752 Dialdehyde_starch
```
```
For index : Dialdehyde_starch=357080752
```
* 9047-50-1 -> 9047-50-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dialdehyde+starch not found on commonchemistry - Dialdehyde+starch

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diallyllysergamide (3605)

* No CASNo

* Diallyllysergamide not found on commonchemistry - Diallyllysergamide

* No ChemSpiderID (correct: 21106294)

* No PubChem

* No InChI

* No SMILES
Diaminopimelic_acid (3606)
```
Botcommand: addindex 352113498 Diaminopimelic_acid
```
```
For index : Diaminopimelic_acid=352113498
```
* 583-93-7 -> 583-93-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Diaminopimelic+acid not found on commonchemistry - Diaminopimelic+acid

* No ChemSpiderID

* PubChem: 99290

* No InChI

* SMILES: N[C@H](CCC[C@H](N)C(=O)O)C(=O)O
Diampromide (3608)
```
Botcommand: addindex 352561612 Diampromide
```
```
For index : Diampromide=352561612
```
* 552-25-0 -> 552-25-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diampromide not found on commonchemistry - Diampromide

* No ChemSpiderID (correct: 56158)

* PubChem: 62370

* No InChI

* No SMILES
Dianeusine (3609)
* No CASNo

* Dianeusine not found on commonchemistry - Dianeusine

* No ChemSpiderID

* PubChem: 156054

* No InChI

* SMILES: O.O[Si](=O)O.O[Si](=O)O.[Mg+2].[Al+3].[Al+3]
Dianicline (3610)
```
Botcommand: addindex 346892363 Dianicline
```
```
For index : Dianicline=346892363
```
* 292634-27-6 -> 292634-27-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dianicline not found on commonchemistry - Dianicline

* No ChemSpiderID

* PubChem: 9816447

* No InChI

* No SMILES
Dianin's_compound (3611)
```
Botcommand: addindex 274840118 Dianin's_compound
```
```
For index : Dianin's_compound=274840118
```
* 472-41-3 -> 472-41-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dianin+s+compound not found on commonchemistry - Dianin+s+compound

* No ChemSpiderID

* PubChem: 97788

* No InChI

* SMILES: CC1(CC(C2=CC=CC=C2O1)(C)C3=CC=C(C=C3)O)C
Diatrizoic_acid (3612)
```
Botcommand: addindex 360861633 Diatrizoic_acid
```
```
For index : Diatrizoic_acid=360861633
```
* 737-31-5 -> 737-31-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Diatrizoic+acid found on commonchemistry - Diatrizoic+acid
* 117-96-4 (exact match)
Name in list

All names: 2,4,6-Triiodo-3,5-diacetamidobenzoic acid, 3,5-Bis(acetylamino)-2,4,6-triiodobenzoic acid, 3,5-Diacetamido-2,4,6-Triiodbenzoesaure, 3,5-diacetamido-2,4,6-triiodobenzoic acid, Acide 3,5-diacetamido-2,4,6-triiodobenzoique, acido 3,5-diacetamido-2,4,6-triiodobenzoico, Amidotrizoic acid, Benzoic acid, 3,5-bis(acetylamino)-2,4,6-triiodo-, Benzoic acid, 3,5-diacetamido-2,4,6-triiodo-, Diatrizoate, [[diatrizoic acid]], NSC 262168, Odiston, Urografin acid, Urogranoic acid, Urotrast

* ChemSpiderID: 2055 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 2140

* No InChI - (ChemSpider: | InChI=InChI=1/C11H9I3N2O4/c1-3(17)15-9-6(12)5(11(19)20)7(13)10(8(9)14)16-4(2)18/h1-2H3,(H,15,17)(H,16,18)(H,19,20) )

* SMILES: CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)NC(=O)C)I - (ChemSpider: | SMILES=Ic1c(c(I)c(c(I)c1NC(=O)C)C(=O)O)NC(=O)C )
Diazene (3613)
```
Botcommand: addindex 364251249 Diazene
```
```
For index : Diazene=364251249
```
* 3618-05-1 (E isomer: 15626-43-4)(Z isomer: 15626-42-3) -> (E isomer: 15626-43-4)(Z isomer: 15626-42-3) 3618-05-1 (E isomer: 15626-43-4)(Z isomer: 15626-42-3) - NOT VERIFIED

* The CAS number '3618-05-1 (E isomer: 15626-43-4)(Z isomer: 15626-42-3)' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Diazene found on commonchemistry - Diazene
* 60-10-6 (Formula: C13H12N4S; Name: Diazenecarbothioic acid, phenyl-, 2-phenylhydrazide)

* 60-11-7 (Formula: C14H15N3; Name: Benzenamine, N,N-dimethyl-4-(phenylazo)-)

* 72-57-1 (Formula: C34H28N6O14S4.4Na; Name: 2,7-Naphthalenedisulfonic acid, 3,3'-[(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[5-amino-4-hydroxy-, tetrasodium salt)

* 78-67-1 (Formula: C8H12N4; Name: Propanenitrile, 2,2'-azobis[2-methyl-)

* 103-33-3 (Formula: C12H10N2; Name: Diazene, diphenyl-)

* 123-77-3 (Formula: C2H4N4O2; Name: Diazenedicarboxamide)

* 495-48-7 (Formula: C12H10N2O; Name: Diazene, diphenyl-, 1-oxide)

* 573-58-0 (Formula: C32H24N6O6S2.2Na; Name: 1-Naphthalenesulfonic acid, 3,3'-[[1,1'-biphenyl]-4,4'-diylbis(azo)]bis[4-amino-, disodium salt)

* 1562-94-3 (Formula: C14H14N2O3; Name: Diazene, bis(4-methoxyphenyl)-, 1-oxide)

* 1972-28-7 (Formula: C6H10N2O4; Name: Diazenedicarboxylic acid, diethyl ester)

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diazodinitrophenol (3616)
```
Botcommand: addindex 345451363 Diazodinitrophenol
```
```
For index : Diazodinitrophenol=345451363
```
* 4682-03-5 -> 4682-03-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Diazodinitrophenol not found on commonchemistry - Diazodinitrophenol

* No ChemSpiderID

* PubChem: 5463880

* No InChI

* SMILES: C1(=O)C(=N=N)CC[N+](=O)[O-]CC1[N+](=O)[O-]
Diazonaphthoquinone (3619)
```
Botcommand: addindex 338582721 Diazonaphthoquinone
```
```
For index : Diazonaphthoquinone=338582721
```
* 879-15-2 -> 879-15-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Diazonaphthoquinone not found on commonchemistry - Diazonaphthoquinone

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: O=C(C(C=C2)=[N]=[N])C1=C2C=CC=C1
Dibekacin (3621)
```
Botcommand: addindex 362913639 Dibekacin
```
```
For index : Dibekacin=362913639
```
* 34493-98-6 -> 34493-98-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibekacin not found on commonchemistry - Dibekacin

* ChemSpiderID: 2913 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 470999

* No InChI - (ChemSpider: | InChI=InChI=1/C18H37N5O8/c19-4-6-1-2-7(20)17(28-6)30-15-8(21)3-9(22)16(14(15)27)31-18-13(26)11(23)12(25)10(5-24)29-18/h6-18,24-27H,1-5,19-23H2 )

* No SMILES - (ChemSpider: | smiles=O(C2C(O)C(OC1OC(CN)CCC1N)C(N)CC2N)C3OC(C(O)C(N)C3O)CO )
Dibenzazepine (3622)

* No CASNo

* Dibenzazepine found on commonchemistry - Dibenzazepine
* 50-49-7 (exact match)
Name in list

All names: [[1-(3-Dimethylaminopropyl)-4,5-dihydro-2,3,6,7-dibenzazepine]], [[5-(3-Dimethylaminopropyl)-10,11-dihydro-5H-dibenz[b,f]azepine]], [[5,6-Dihydro-N-[3-(dimethylamino)propyl]-11H-dibenz[b,e]azepine]], [[5H-Dibenz[b,f]azepine, 5-[3-(dimethylamino)propyl]-10,11-dihydro-]], [[5H-Dibenz[b,f]azepine-5-propanamine, 10,11-dihydro-N,N-dimethyl-]], Antideprin, Berkomine, Cristalia, Imipramin, imipramina, imipramine, Melipramine, N-(3-Dimethylaminopropyl)-o-iminodibenzyl, N-(Î³-Dimethylaminopropyl)iminodibenzyl, NSC 169866, Org 2463, Prazepine

* ChemSpiderID: 8857 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 9212

* InChI: InChI=1S/C14H11N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10,15H - (ChemSpider: | InChI=InChI=1/C14H11N/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)15-13/h1-10,15H )

* SMILES: c3cc2c(\C=C/c1c(cccc1)N2)cc3 - (ChemSpider: | SMILES=c3cc2c(\C=C/c1c(cccc1)N2)cc3 )
Dibenzepin (3623)
```
Botcommand: addindex 351998268 Dibenzepin
```
```
For index : Dibenzepin=351998268
```
* 4498-32-2 -> 4498-32-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibenzepin not found on commonchemistry - Dibenzepin

* No ChemSpiderID (correct: 9048)

* PubChem: 9419

* No InChI

* No SMILES
Dibenzocycloheptene (3625)
```
Botcommand: addindex 353635083 Dibenzocycloheptene
```
```
For index : Dibenzocycloheptene=353635083
```
* 833-48-7 -> 833-48-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibenzocycloheptene not found on commonchemistry - Dibenzocycloheptene

* ChemSpiderID: 63219 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 70029

* InChI: InChI=1S/C15H14/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-8H,9-11H2 - (ChemSpider: | InChI=InChI=1/C15H14/c1-3-7-14-11-15-8-4-2-6-13(15)10-9-12(14)5-1/h1-8H,9-11H2 )

* SMILES: c1cc3c(cc1)Cc2c(cccc2)CC3 - (ChemSpider: | SMILES=c1cc3c(cc1)Cc2c(cccc2)CC3 )
Dibenzoylmorphine (3629)

* No CASNo

* Dibenzoylmorphine not found on commonchemistry - Dibenzoylmorphine

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dibenzylideneacetone (3631)
```
Botcommand: addindex 353392555 Dibenzylideneacetone
```
```
For index : Dibenzylideneacetone=353392555
```
* 538-58-9 -> 538-58-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibenzylideneacetone found on commonchemistry - Dibenzylideneacetone
* 51364-51-3 (exact match)
Name in list

All names: [[Palladium, tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]di-]], [[Palladium, tris[Î¼-[(1,2-Î·:4,5-Î·)-1,5-diphenyl-1,4-pentadien-3-one]]di-, (all-E)-]], Pd2(DBA)3, [[Tris(dibenzylideneacetone)dipalladium]], Tris(dibenzylideneacetonyl)bis-palladium, [[Tris[(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]dipalladium]], [[Tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]dipalladium]], [[tris[Î¼-[(1,2-Î·:4,5-Î·)-(1E,4E)-1,5-diphenyl-1,4-pentadien-3-one]]dipalladium [Pd2(dba)3]]]

* No ChemSpiderID (correct: 1266463)

* No PubChem

* No InChI

* SMILES: O=C(/C=C/c1ccccc1)/C=C/c2ccccc2
Dibenzylpiperazine (3632)
```
Botcommand: addindex 320299564 Dibenzylpiperazine
```
```
For index : Dibenzylpiperazine=320299564
```
* 2298-55-7 -> 2298-55-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibenzylpiperazine not found on commonchemistry - Dibenzylpiperazine

* No ChemSpiderID

* PubChem: 200601

* No InChI

* SMILES: C1CN(CCN1CC2=CC=CC=C2)CC3=CC=CC=C3
Diboron_tetrafluoride (3634)
```
Botcommand: addindex 363373505 Diboron_tetrafluoride
```
```
For index : Diboron_tetrafluoride=363373505
```
* 13965-73-6 -> 13965-73-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diboron+tetrafluoride not found on commonchemistry - Diboron+tetrafluoride

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dibromodifluoromethane (3636)
```
Botcommand: addindex 346782644 Dibromodifluoromethane
```
```
For index : Dibromodifluoromethane=346782644
```
* 75-61-6 -> 75-61-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibromodifluoromethane not found on commonchemistry - Dibromodifluoromethane

* No ChemSpiderID

* PubChem: 6382

* InChI: 1/CBr2F2/c2-1(3,4)5

* SMILES: C(F)(F)(Br)Br
Dibromofluoromethane (3637)
```
Botcommand: addindex 341848396 Dibromofluoromethane
```
```
For index : Dibromofluoromethane=341848396
```
* 1868-53-7 -> 1868-53-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibromofluoromethane not found on commonchemistry - Dibromofluoromethane

* No ChemSpiderID

* PubChem: 61280

* InChI: 1/CHBr2F/c2-1(3)4/h1H

* SMILES: C(F)(Br)Br
Dibromotetrafluoroethane (3639)
```
Botcommand: addindex 341848375 Dibromotetrafluoroethane
```
```
For index : Dibromotetrafluoroethane=341848375
```
* 124-73-2 -> 124-73-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibromotetrafluoroethane not found on commonchemistry - Dibromotetrafluoroethane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dibromotyrosine (3640)
```
Botcommand: addindex 325870810 Dibromotyrosine
```
```
For index : Dibromotyrosine=325870810
```
* 300-38-9 -> 300-38-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibromotyrosine not found on commonchemistry - Dibromotyrosine

* No ChemSpiderID

* PubChem: 10833

* No InChI

* No SMILES
Dibrompropamidine (3641)
```
Botcommand: addindex 296360280 Dibrompropamidine
```
```
For index : Dibrompropamidine=296360280
```
* 496-00-4 -> 496-00-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibrompropamidine not found on commonchemistry - Dibrompropamidine

* No ChemSpiderID (correct: 11479)

* PubChem: 11974

* No InChI

* SMILES: C1=CC(=C(C=C1C(=N)N)Br)OCCCOC2=C(C=C(C=C2)C(=N)N)Br
Dibunate (3642)
```
Botcommand: addindex 343829881 Dibunate
```
```
For index : Dibunate=343829881
```
* 14992-58-6 -> 14992-58-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibunate not found on commonchemistry - Dibunate

* No ChemSpiderID

* PubChem: 84747

* No InChI

* No SMILES
Dibutylamine (3645)
```
Botcommand: addindex 332928677 Dibutylamine
```
```
For index : Dibutylamine=332928677
```
* 111-92-2 -> 111-92-2 - NOT VERIFIED

* CAS found on commonchemistry - 111-92-2 - name in list
All names: 1-Butanamine, N-butyl-, 206: PN: WO2004005270 PAGE: 28-29 claimed sequence, dibutilamina, Dibutylamin, Dibutylamine, Di-n-butylamine, N,N-Dibutylamine, N,N-Di-n-butylamine, N-Butyl-1-butanamine, n-Dibutylamine, UN 2248, UN 2248

* Dibutylamine found on commonchemistry - Dibutylamine
* 111-92-2 (exact match) Matches CAS (111-92-2) on page
Name in list

All names: 1-Butanamine, N-butyl-, 206: PN: WO2004005270 PAGE: 28-29 claimed sequence, dibutilamina, Dibutylamin, [[dibutylamine]], Di-n-butylamine, [[N,N-dibutylamine]], N,N-Di-n-butylamine, N-Butyl-1-butanamine, [[n-dibutylamine]], UN 2248, UN 2248

* No ChemSpiderID

* PubChem: 8148

* No InChI

* No SMILES
Dibutyltryptamine (3647)
```
Botcommand: addindex 328735681 Dibutyltryptamine
```
```
For index : Dibutyltryptamine=328735681
```
* 15741-77-2 -> 15741-77-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dibutyltryptamine not found on commonchemistry - Dibutyltryptamine

* No ChemSpiderID (correct: 25911)

* PubChem: 27848

* No InChI

* No SMILES
Dicalcium_citrate (3648)
```
Botcommand: addindex 265826165 Dicalcium_citrate
```
```
For index : Dicalcium_citrate=265826165
```
* 1185-56-4 -> 1185-56-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dicalcium+citrate not found on commonchemistry - Dicalcium+citrate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: [O-]C(CC(C(O)=O)(O)CC([O-])=O)=O.[Ca+2]

3651 to 3700

Dicarbon_monoxide (3651)
```
Botcommand: addindex 347678533 Dicarbon_monoxide
```
```
For index : Dicarbon_monoxide=347678533
```
* 12071-23-7 -> 12071-23-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dicarbon+monoxide not found on commonchemistry - Dicarbon+monoxide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: [C]=C=O
Dicarbonyltris(triphenylphosphine)ruthenium(0) (3652)
* No CASNo

* Dicarbonyltris+triphenylphosphine+ruthenium not found on commonchemistry - Dicarbonyltris+triphenylphosphine+ruthenium

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichlofenthion (3653)
```
Botcommand: addindex 349314862 Dichlofenthion
```
```
For index : Dichlofenthion=349314862
```
* 97-17-6 -> 97-17-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlofenthion not found on commonchemistry - Dichlofenthion

* No ChemSpiderID

* PubChem: 7328

* No InChI

* SMILES: CCOP(=S)(OCC)Oc1cc(Cl)cc(Cl)c1
Dichloralphenazone (3654)
```
Botcommand: addindex 275688104 Dichloralphenazone
```
```
For index : Dichloralphenazone=275688104
```
* 480-30-8 -> 480-30-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichloralphenazone not found on commonchemistry - Dichloralphenazone

* No ChemSpiderID (correct: 9776)

* PubChem: 10188

* No InChI

* No SMILES
Dichloramine (3655)

* No CASNo

* Dichloramine not found on commonchemistry - Dichloramine

* ChemSpiderID: 69389 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 76939

* InChI: InChI=1S/Cl2HN/c1-3-2/h3H - (ChemSpider: | InChI=InChI=1/Cl2HN/c1-3-2/h3H )

* SMILES: ClNCl - (ChemSpider: | SMILES=ClNCl )
Dichlorine_heptoxide (3656)
```
Botcommand: addindex 361940540 Dichlorine_heptoxide
```
```
For index : Dichlorine_heptoxide=361940540
```
* 10294-48-1 -> 10294-48-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorine+heptoxide not found on commonchemistry - Dichlorine+heptoxide

* No ChemSpiderID

* PubChem: 123272

* No InChI

* SMILES: O=Cl(=O)(=O)OCl(=O)(=O)=O
Dichlorine_hexoxide (3657)
```
Botcommand: addindex 361596899 Dichlorine_hexoxide
```
```
For index : Dichlorine_hexoxide=361596899
```
* 12442-63-6 -> 12442-63-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorine+hexoxide not found on commonchemistry - Dichlorine+hexoxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichlorine_monoxide (3658)
```
Botcommand: addindex 361727556 Dichlorine_monoxide
```
```
For index : Dichlorine_monoxide=361727556
```
* 7791-21-1 -> 7791-21-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorine+monoxide not found on commonchemistry - Dichlorine+monoxide

* No ChemSpiderID

* PubChem: 24646

* No InChI

* No SMILES
Dichlorine_trioxide (3659)
```
Botcommand: addindex 332447752 Dichlorine_trioxide
```
```
For index : Dichlorine_trioxide=332447752
```
* 17496-59-2 -> 17496-59-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorine+trioxide not found on commonchemistry - Dichlorine+trioxide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichloro(1,3-bis(diphenylphosphino)propane)nickel (3660)
```
Botcommand: addindex 358418067 Dichloro(1,3-bis(diphenylphosphino)propane)nickel
```
```
For index : Dichloro(1,3-bis(diphenylphosphino)propane)nickel=358418067
```
* 15629-92-2 -> 15629-92-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichloro+bis+diphenylphosphino+propane+nickel not found on commonchemistry - Dichloro+bis+diphenylphosphino+propane+nickel

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichloro(cycloocta-1,5-diene)platinum(II) (3661)
```
Botcommand: addindex 332447778 Dichloro(cycloocta-1,5-diene)platinum(II)
```
```
For index : Dichloro(cycloocta-1,5-diene)platinum(II)=332447778
```
* 12080-32-9 -> 12080-32-9 - NOT VERIFIED

* CAS found on commonchemistry - 12080-32-9 - name not in list
All names: (1,5-Cyclooctadiene)platinum dichloride, (1,5-Cyclooctadiene)platinum(II) dichloride, 1,5-Cyclooctadienedichloroplatinum, Dichloro(1,5-cyclooctadiene)platinum, Dichloro(1,5-cyclooctadiene)-platinum(II), [[Dichloro[(1,2,5,6-Î·)-cycloocta-1,5-dien]platin]], [[Dichloro[(1,2,5,6-Î·)-cycloocta-1,5-diene]platine]], [[dichloro[(1,2,5,6-Î·)-cycloocta-1,5-diene]platinum]], [[dicloro[(1,2,5,6-Î·)-cicloocta-1,5-dien]platino]], NSC 239486, Platinum, dichloro(1,5-cyclooctadiene)-, [[Platinum, dichloro[(1,2,5,6-Î·)-1,5-cyclooctadiene]-]]

* Dichloro+cycloocta+diene+platinum+II not found on commonchemistry - Dichloro+cycloocta+diene+platinum+II

* No ChemSpiderID

* PubChem: 5702648

* No InChI

* No SMILES
Dichloroacetamide (3662)
```
Botcommand: addindex 293851408 Dichloroacetamide
```
```
For index : Dichloroacetamide=293851408
```
* 683-72-7 -> 683-72-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichloroacetamide not found on commonchemistry - Dichloroacetamide

* No ChemSpiderID

* PubChem: 12694

* No InChI

* SMILES: C(C(=O)N)(Cl)Cl
Dichlorobis(ethylenediamine)nickel(II) (3664)
```
Botcommand: addindex 286566137 Dichlorobis(ethylenediamine)nickel(II)
```
```
For index : Dichlorobis(ethylenediamine)nickel(II)=286566137
```
* 22980-82-1 -> 22980-82-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorobis+ethylenediamine+nickel+II not found on commonchemistry - Dichlorobis+ethylenediamine+nickel+II

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichlorodifluoroethylene (3666)
```
Botcommand: addindex 353672081 Dichlorodifluoroethylene
```
```
For index : Dichlorodifluoroethylene=353672081
```
* 79-35-6 -> 79-35-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorodifluoroethylene not found on commonchemistry - Dichlorodifluoroethylene

* No ChemSpiderID

* PubChem: 6592

* No InChI

* SMILES: C(=C(Cl)Cl)(F)F
Dichloroisocyanuric_acid (3671)
```
Botcommand: addindex 341575514 Dichloroisocyanuric_acid
```
```
For index : Dichloroisocyanuric_acid=341575514
```
* 2782-57-2 -> 2782-57-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichloroisocyanuric+acid found on commonchemistry - Dichloroisocyanuric+acid
* 2893-78-9 (exact match)
Name in list

All names: 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt, 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt (1:1), 1,3,5-Triazine-2,4,6-(1H,3H,5H)-trione.1,3-dicloro-,sodium salt, 1,3-Dichloro-1,3,5-triazine-2,4,6(1H,3H,5H)-trione sodium salt, 3,5-Dichloro-2-hydroxy-4,6-s-triazinedione sodium salt, ACL 56, ACL 60, Actisan, Basolan DC, CDB 63, CDB Clearon, Clearon, Clearon CDB, Clearon CDB 56, Crente, DICHLOROISOCYANURATE, SODIUM, [[dichloroisocyanuric acid sodium salt]], [[dichloroisocyanuric acid, sodium salt]], Dichloro-s-triazine-2,4,6-trione, sodium salt, Dichloro-s-triazinetrione sodium salt, Dichlosia, Dikonit, Fi Clor 60S, Fi Clor Clearon, Fichlor, Hi-Lite 60C, Hi-Lite 60G, Hi-Lite G 60GW, ISOCYANURATE, DICHLORO-, SODIUM, Izosan G, NATRIUMDICHLORISOCYANURAT, Neochlor 60G, Neochlor 60P, Oniachlor 60, Oxidan DCN/WSG, Presept, Prisept, SDIC 60P, SDIC-MG, Simpla, Sodium dichlorisocyanurate, SODIUM DICHLORO ISOCYANURATE, Sodium dichlorocyanurate, Sodium dichloroisocyanurate, Sodium dichloro-s-triazinetrione, SODIUM DICHLORO-S-TRIAZINE-TRIONE, s-Triazine-2,4,6(1H,3H,5H)-trione, 1,3-dichloro-, sodium salt, Surchlor GR 60, Troclosene sodique, troclosene sodium, Troclosennatrium, trocloseno sodico, UN 2465, UN 2465, Vac Attack

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: C1(=O)NC(=O)N(C(=O)N1Cl)Cl
Dichloroisoprenaline (3672)
```
Botcommand: addindex 351653774 Dichloroisoprenaline
```
```
For index : Dichloroisoprenaline=351653774
```
* 59-61-0 -> 59-61-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichloroisoprenaline not found on commonchemistry - Dichloroisoprenaline

* No ChemSpiderID (correct: 5601)

* PubChem: 5806

* No InChI

* SMILES: CC(C)NCC(C1=CC(=C(C=C1)Cl)Cl)O
Dichloropane (3674)
```
Botcommand: addindex 358324692 Dichloropane
```
```
For index : Dichloropane=358324692
```
* 146725-34-0 -> 146725-34-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichloropane not found on commonchemistry - Dichloropane

* No ChemSpiderID

* PubChem: 127024

* No InChI

* No SMILES
Dichlorophen (3675)
```
Botcommand: addindex 283208328 Dichlorophen
```
```
For index : Dichlorophen=283208328
```
* 97-23-4 -> 97-23-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorophen found on commonchemistry - Dichlorophen
* 58-54-8 (Formula: C13H12Cl2O4; Name: Acetic acid, [2,3-dichloro-4-(2-methylene-1-oxobutyl)phenoxy]-)

* 87-65-0 (Formula: C6H4Cl2O; Name: Phenol, 2,6-dichloro-)

* 94-75-7 (Formula: C8H6Cl2O3; Name: Acetic acid, (2,4-dichlorophenoxy)-)

* 94-82-6 (Formula: C10H10Cl2O3; Name: Butanoic acid, 4-(2,4-dichlorophenoxy)-)

* 95-76-1 (Formula: C6H5Cl2N; Name: Benzenamine, 3,4-dichloro-)

* 95-77-2 (Formula: C6H4Cl2O; Name: Phenol, 3,4-dichloro-)

* 101-20-2 (Formula: C13H9Cl3N2O; Name: Urea, N-(4-chlorophenyl)-N'-(3,4-dichlorophenyl)-)

* 120-36-5 (Formula: C9H8Cl2O3; Name: Propanoic acid, 2-(2,4-dichlorophenoxy)-)

* 120-83-2 (Formula: C6H4Cl2O; Name: Phenol, 2,4-dichloro-)

* 120-97-8 (Formula: C6H6Cl2N2O4S2; Name: 1,3-Benzenedisulfonamide, 4,5-dichloro-)

* No ChemSpiderID

* PubChem: 3037

* No InChI

* No SMILES
Dichlorophene (3676)
```
Botcommand: addindex 360259837 Dichlorophene
```
```
For index : Dichlorophene=360259837
```
* 97-23-4 -> 97-23-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Dichlorophene not found on commonchemistry - Dichlorophene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichlorotetrakis(dimethyl_sulfoxide)ruthenium(II) (3680)
```
Botcommand: addindex 349931559 Dichlorotetrakis(dimethyl_sulfoxide)ruthenium(II)
```
```
For index : Dichlorotetrakis(dimethyl_sulfoxide)ruthenium(II)=349931559
```
* [11070-19-2] -> [11070-19-2 [11070-19-2]] - NOT VERIFIED

* The CAS number '[11070-19-2]' is not formatted correctly, please repair the contents of the field CASNo or CAS_number

* Dichlorotetrakis+dimethyl+sulfoxide+ruthenium+II not found on commonchemistry - Dichlorotetrakis+dimethyl+sulfoxide+ruthenium+II

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dichlorotris(triphenylphosphine)ruthenium(II) (3681)
```
Botcommand: addindex 364873237 Dichlorotris(triphenylphosphine)ruthenium(II)
```
```
For index : Dichlorotris(triphenylphosphine)ruthenium(II)=364873237
```
* 15529-49-4 -> 15529-49-4 - NOT VERIFIED

* CAS found on commonchemistry - 15529-49-4 - name not in list
All names: dichlorotris(triphenylphosphine)ruthenium, Dichlorotris(triphenylphospine)ruthenium, Dichlortris(triphenylphosphin)ruthenium, diclorotris(trifenilfosfina)rutenio, Ruthenium tris(triphenylphosphine) dichloride, Ruthenium, dichlorotris(triphenylphosphine)-, Tris(triphenylphosphine)dichlororuthenium, TRIS(TRIPHENYLPHOSPHINE)RUTHENIUM (II) CHLORIDE, Tris(triphenylphosphine)ruthenium dichloride, Tris(triphenylphosphine)ruthenium(II) dichloride

* Dichlorotris+triphenylphosphine+ruthenium+II not found on commonchemistry - Dichlorotris+triphenylphosphine+ruthenium+II

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diclazuril (3684)
```
Botcommand: addindex 341850278 Diclazuril
```
```
For index : Diclazuril=341850278
```
* 101831-37-2 -> 101831-37-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Diclazuril not found on commonchemistry - Diclazuril

* No ChemSpiderID

* PubChem: 456389

* No InChI

* No SMILES
Diclofenac/misoprostol (3686)
* No CASNo

* Diclofenac+misoprostol not found on commonchemistry - Diclofenac+misoprostol

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diclofensine (3688)
```
Botcommand: addindex 348048435 Diclofensine
```
```
For index : Diclofensine=348048435
```
* 67165-56-4 -> 67165-56-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Diclofensine not found on commonchemistry - Diclofensine

* No ChemSpiderID

* PubChem: 68871

* No InChI

* No SMILES
Dicobalt_edetate (3690)
```
Botcommand: addindex 364227854 Dicobalt_edetate
```
```
For index : Dicobalt_edetate=364227854
```
* 36499-65-7 -> 36499-65-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dicobalt+edetate not found on commonchemistry - Dicobalt+edetate

* No ChemSpiderID

* PubChem: 71942

* No InChI

* SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Co+2].[Co+2]
Dicoronylene (3693)

* No CASNo

* Dicoronylene not found on commonchemistry - Dicoronylene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dicrotophos (3695)
```
Botcommand: addindex 352634120 Dicrotophos
```
```
For index : Dicrotophos=352634120
```
* 3735-78-2 -> 3735-78-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Dicrotophos not found on commonchemistry - Dicrotophos

* No ChemSpiderID

* PubChem: 5371560

* No InChI

* SMILES: C/C(=C\C(=O)N(C)C)/OP(=O)(OC)OC
Dicyanoacetylene (3696)
```
Botcommand: addindex 359519434 Dicyanoacetylene
```
```
For index : Dicyanoacetylene=359519434
```
* 1071-98-3 -> 1071-98-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Dicyanoacetylene not found on commonchemistry - Dicyanoacetylene

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dicyclohexylurea (3697)

* No CASNo

* Dicyclohexylurea not found on commonchemistry - Dicyclohexylurea

* ChemSpiderID: 4126 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 4277

* InChI: InChI=1S/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) - (ChemSpider: | InChI=InChI=1/C13H24N2O/c16-13(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2,(H2,14,15,16) )

* SMILES: O=C(NC1CCCCC1)NC2CCCCC2 - (ChemSpider: | SMILES=O=C(NC1CCCCC1)NC2CCCCC2 )

3701 to 3750

Didecyldimethylammonium_chloride (3701)
```
Botcommand: addindex 333962782 Didecyldimethylammonium_chloride
```
```
For index : Didecyldimethylammonium_chloride=333962782
```
* 7173-51-5 -> 7173-51-5 - NOT VERIFIED

* CAS found on commonchemistry - 7173-51-5 - name in list
All names: 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride, 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1), AMMONIUM CHLORIDE, N,N-DIDECYL-N,N-DIMETHYL-, Ammonium, didecyldimethyl-, chloride, AQ 210, Arquad 10, Arquad 210, Arquad 210-50, Arquad 210-50E, Arquad 210-80, Arquad 210-80E, Astop, Bardac 22, Bardac 2250, Bardac 2270E, Bardac 2280, Bio-Dac, Britewood Q, Britewood XL, BTC 1010, BTC 2250, BTC 99, Calgon H 130, Catiogen DDM, Cation DDC, Chlorure de didecyldimethylammonium, cloruro de didecildimetilamonio, D 10P, DDAC, DDC 80, DIDECYL DIMETHYL AMMONIUM CHLORIDE, didecyldimethylammonium chloride, Didecyldimethylammoniumchlorid, DIDECYL-DIMETHYL-AMMONIUM-CHLORID, Didecyldimethylammounium chloride, Dimethyldidecylammonium chloride, Dodigen 1881, H 130, H 130 (molluscicide), Kamin RM 2D50A, Macrotrol MT 200, Maquat 4480E, Microbiocide B 74, Nissan Cation 2DB, Quartamin D 10E, Quartamin D 10P, Quaternium 12, Querton 210CL, Slaoff 91, Sporekill, Stenquat 1010, Timbercote 2000, Tret-O-Lite XC 507

* Didecyldimethylammonium+chloride found on commonchemistry - Didecyldimethylammonium+chloride
* 7173-51-5 (exact match) Matches CAS (7173-51-5) on page
Name in list

All names: 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride, 1-Decanaminium, N-decyl-N,N-dimethyl-, chloride (1:1), AMMONIUM CHLORIDE, N,N-DIDECYL-N,N-DIMETHYL-, Ammonium, didecyldimethyl-, chloride, AQ 210, Arquad 10, Arquad 210, Arquad 210-50, Arquad 210-50E, Arquad 210-80, Arquad 210-80E, Astop, Bardac 22, Bardac 2250, Bardac 2270E, Bardac 2280, Bio-Dac, Britewood Q, Britewood XL, BTC 1010, BTC 2250, BTC 99, Calgon H 130, Catiogen DDM, Cation DDC, Chlorure de didecyldimethylammonium, cloruro de didecildimetilamonio, D 10P, DDAC, DDC 80, DIDECYL DIMETHYL AMMONIUM CHLORIDE, [[didecyldimethylammonium chloride]], Didecyldimethylammoniumchlorid, DIDECYL-DIMETHYL-AMMONIUM-CHLORID, Didecyldimethylammounium chloride, Dimethyldidecylammonium chloride, Dodigen 1881, H 130, H 130 (molluscicide), Kamin RM 2D50A, Macrotrol MT 200, Maquat 4480E, Microbiocide B 74, Nissan Cation 2DB, Quartamin D 10E, Quartamin D 10P, Quaternium 12, Querton 210CL, Slaoff 91, Sporekill, Stenquat 1010, Timbercote 2000, Tret-O-Lite XC 507

* No ChemSpiderID

* PubChem: 23558

* No InChI

* SMILES: CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[Cl-]
Didesmethylcitalopram (3702)

* No CASNo

* Didesmethylcitalopram not found on commonchemistry - Didesmethylcitalopram

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Dienogest (3705)
```
Botcommand: addindex 354416156 Dienogest
```
```
For index : Dienogest=354416156
```
* 65928-58-7 -> 65928-58-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Dienogest not found on commonchemistry - Dienogest

* No ChemSpiderID

* PubChem: 68861

* No InChI

* No SMILES
Diethyl_carbonate (3708)
```
Botcommand: addindex 360679723 Diethyl_carbonate
```
```
For index : Diethyl_carbonate=360679723
```
* 105-58-8 -> 105-58-8 - NOT VERIFIED

* CAS found on commonchemistry - 105-58-8 - name in list
All names: Carbonate de diethyle, carbonato de dietilo, CARBONIC ACID, Carbonic acid diethyl ester, CARBONIC ACID- DIETHYL ESTER, Carbonic acid, diethyl ester, DEC, DIAETHYLCARBONAT, Diatol, Diatol (carbonate), diethyl carbonate, Diethylcarbonat, Ethyl carbonate, Ethyl carbonate ((EtO)2CO), Eufin, H-DEC, NSC 8849, UN 2366, UN 2366

* Diethyl+carbonate found on commonchemistry - Diethyl+carbonate
* 105-58-8 (exact match) Matches CAS (105-58-8) on page
Name in list

All names: Carbonate de diethyle, carbonato de dietilo, CARBONIC ACID, Carbonic acid diethyl ester, CARBONIC ACID- DIETHYL ESTER, Carbonic acid, diethyl ester, DEC, DIAETHYLCARBONAT, Diatol, Diatol (carbonate), [[diethyl carbonate]], Diethylcarbonat, Ethyl carbonate, Ethyl carbonate ((EtO)2CO), Eufin, H-DEC, NSC 8849, UN 2366, UN 2366

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diethyl_ether_peroxide (3710)
```
Botcommand: addindex 358776922 Diethyl_ether_peroxide
```
```
For index : Diethyl_ether_peroxide=358776922
```
* 18321-53-4 -> 18321-53-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethyl+ether+peroxide not found on commonchemistry - Diethyl+ether+peroxide

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCOC(OO)C
Diethyl_sulfite (3715)
```
Botcommand: addindex 350975747 Diethyl_sulfite
```
```
For index : Diethyl_sulfite=350975747
```
* 623-81-4 -> 623-81-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethyl+sulfite not found on commonchemistry - Diethyl+sulfite

* No ChemSpiderID

* PubChem: 12197

* No InChI

* SMILES: CCOS(=O)OCC
Diethyl_sulfoxide (3716)
```
Botcommand: addindex 332256631 Diethyl_sulfoxide
```
```
For index : Diethyl_sulfoxide=332256631
```
* 70-29-1 -> 70-29-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethyl+sulfoxide not found on commonchemistry - Diethyl+sulfoxide

* No ChemSpiderID

* PubChem: 6263

* No InChI

* No SMILES
Diethylaluminium_chloride (3718)
```
Botcommand: addindex 341693123 Diethylaluminium_chloride
```
```
For index : Diethylaluminium_chloride=341693123
```
* 96-10-6 -> 96-10-6 - NOT VERIFIED

* CAS found on commonchemistry - 96-10-6 - name in list
All names: Aluminium, chlorodiethyl-, Aluminum, chlorodiethyl-, Aluminum, dichlorotetraethyldi-, Chlorodiethylaluminum, Chlorure de diethylaluminium, cloruro de dietilaluminio, DIAETHYLALUMINIUMCHLORID, DIETHYL ALUMINUM CHLORIDE, diethylaluminium chloride, Diethylaluminiumchlorid, Diethylaluminum chloride, Diethylaluminum monochloride, Diethylchloroaluminum, UN 3051

* Diethylaluminium+chloride found on commonchemistry - Diethylaluminium+chloride
* 96-10-6 (exact match) Matches CAS (96-10-6) on page
Name in list

All names: Aluminium, chlorodiethyl-, Aluminum, chlorodiethyl-, Aluminum, dichlorotetraethyldi-, Chlorodiethylaluminum, Chlorure de diethylaluminium, cloruro de dietilaluminio, DIAETHYLALUMINIUMCHLORID, DIETHYL ALUMINUM CHLORIDE, [[diethylaluminium chloride]], Diethylaluminiumchlorid, Diethylaluminum chloride, Diethylaluminum monochloride, Diethylchloroaluminum, UN 3051

* ChemSpiderID: 10413126 - UNKNOWN - Retrieved data from ChemSpider

* No PubChem

* No InChI - (ChemSpider: | InChI=InChI=1/2C2H5.Al.ClH/c2*1-2;;/h2*1H2,2H3;;1H/q;;+1;/p-1/rC4H10AlCl/c1-3-5(6)4-2/h3-4H2,1-2H3 )

* SMILES: CC[Al](Cl)CC - (ChemSpider: | SMILES=CC[Al](Cl)CC )
Diethylaluminium_cyanide (3719)
```
Botcommand: addindex 362556895 Diethylaluminium_cyanide
```
```
For index : Diethylaluminium_cyanide=362556895
```
* 5804-85-3 -> 5804-85-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethylaluminium+cyanide not found on commonchemistry - Diethylaluminium+cyanide

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diethylamine (3720)
```
Botcommand: addindex 321334307 Diethylamine
```
```
For index : Diethylamine=321334307
```
* 109-89-7 -> 109-89-7 - NOT VERIFIED

* CAS found on commonchemistry - 109-89-7 - name in list
All names: DEA, DIAETHYLAMIN, Diethamine, Diethylamin, Diethylamine, dietilamina, Ethanamine, N-ethyl-, N,N-Diethylamine, N-Ethylethanamine, UN 1154, UN 1154

* Diethylamine found on commonchemistry - Diethylamine
* 109-89-7 (Formula: C4H11N; Name: Ethanamine, N-ethyl-) Matches CAS (109-89-7) on page

* 51-75-2 (Formula: C5H11Cl2N; Name: Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl-)

* 51-85-4 (Formula: C4H12N2S2; Name: Ethanamine, 2,2'-dithiobis-)

* 55-18-5 (Formula: C4H10N2O; Name: Ethanamine, N-ethyl-N-nitroso-)

* 55-86-7 (Formula: C5H11Cl2N.ClH; Name: Ethanamine, 2-chloro-N-(2-chloroethyl)-N-methyl-, hydrochloride)

* 81-88-9 (Formula: C28H31N2O3.Cl; Name: Xanthylium, 9-(2-carboxyphenyl)-3,6-bis(diethylamino)-, chloride)

* 91-66-7 (Formula: C10H15N; Name: Benzenamine, N,N-diethyl-)

* 100-35-6 (Formula: C6H14ClN; Name: Ethanamine, 2-chloro-N,N-diethyl-)

* 100-36-7 (Formula: C6H16N2; Name: 1,2-Ethanediamine, N,N-diethyl-)

* 100-37-8 (Formula: C6H15NO; Name: Ethanol, 2-(diethylamino)-)

* No ChemSpiderID (correct: 7730)

* No PubChem

* No InChI

* SMILES: CCNCC
Diethylamino_hydroxybenzoyl_hexyl_benzoate (3721)
```
Botcommand: addindex 345411522 Diethylamino_hydroxybenzoyl_hexyl_benzoate
```
```
For index : Diethylamino_hydroxybenzoyl_hexyl_benzoate=345411522
```
* 302776-68-7 -> 302776-68-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethylamino+hydroxybenzoyl+hexyl+benzoate not found on commonchemistry - Diethylamino+hydroxybenzoyl+hexyl+benzoate

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: CCCCCCOC(=O)C1=CC=CC=C1C(=O)C2=C(C(=CC=C2)N(CC)CC)O
Diethylaminosulfur_trifluoride (3722)
```
Botcommand: addindex 353020218 Diethylaminosulfur_trifluoride
```
```
For index : Diethylaminosulfur_trifluoride=353020218
```
* 38078-09-0 -> 38078-09-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethylaminosulfur+trifluoride not found on commonchemistry - Diethylaminosulfur+trifluoride

* No ChemSpiderID

* No PubChem

* No InChI

* SMILES: FS(F)(F)N(CC)CC
Diethylene_glycol_dinitrate (3725)
```
Botcommand: addindex 347293818 Diethylene_glycol_dinitrate
```
```
For index : Diethylene_glycol_dinitrate=347293818
```
* 693-21-0 -> 693-21-0 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethylene+glycol+dinitrate not found on commonchemistry - Diethylene+glycol+dinitrate

* No ChemSpiderID

* PubChem: 61198

* No InChI

* SMILES: C(CO[N+](=O)[O-])OCCO[N+](=O)[O-]
Diethylmercury (3728)
```
Botcommand: addindex 361064382 Diethylmercury
```
```
For index : Diethylmercury=361064382
```
* 627-44-1 -> 627-44-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethylmercury not found on commonchemistry - Diethylmercury

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES
Diethylthiambutene (3731)
```
Botcommand: addindex 302522429 Diethylthiambutene
```
```
For index : Diethylthiambutene=302522429
```
* 86-14-6 -> 86-14-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethylthiambutene not found on commonchemistry - Diethylthiambutene

* No ChemSpiderID (correct: 6572)

* PubChem: 149833

* No InChI

* No SMILES
Diethyltryptamine (3732)
```
Botcommand: addindex 328735786 Diethyltryptamine
```
```
For index : Diethyltryptamine=328735786
```
* 7558-72-7 -> 7558-72-7 - NOT VERIFIED

* CAS not found on commonchemistry

* Diethyltryptamine not found on commonchemistry - Diethyltryptamine

* No ChemSpiderID (correct: 5865)

* PubChem: 6090

* No InChI

* No SMILES
Dieticyclidine (3734)
```
Botcommand: addindex 349569335 Dieticyclidine
```
```
For index : Dieticyclidine=349569335
```
* 2201-19-6 -> 2201-19-6 - NOT VERIFIED

* CAS not found on commonchemistry

* Dieticyclidine not found on commonchemistry - Dieticyclidine

* No ChemSpiderID

* PubChem: 604690

* No InChI

* No SMILES
Difemerine (3735)
```
Botcommand: addindex 348541918 Difemerine
```
```
For index : Difemerine=348541918
```
* 3477-97-2 -> 3477-97-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Difemerine not found on commonchemistry - Difemerine

* No ChemSpiderID

* PubChem: 165124

* No InChI

* No SMILES
Difemetorex (3736)
```
Botcommand: addindex 353207578 Difemetorex
```
```
For index : Difemetorex=353207578
```
* 13862-07-2 -> 13862-07-2 - NOT VERIFIED

* CAS not found on commonchemistry

* Difemetorex not found on commonchemistry - Difemetorex

* ChemSpiderID: 59048 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 65607

* No InChI - (ChemSpider: | InChI=InChI=1/C20H25NO/c22-16-15-21-14-8-7-13-19(21)20(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,19-20,22H,7-8,13-16H2 )

* No SMILES - (ChemSpider: | smiles=OCCN1C(CCCC1)C(c2ccccc2)c3ccccc3 )
Difenacoum (3737)
```
Botcommand: addindex 354479862 Difenacoum
```
```
For index : Difenacoum=354479862
```
* 56073-07-5 -> 56073-07-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Difenacoum not found on commonchemistry - Difenacoum

* No ChemSpiderID

* PubChem: 41735

* No InChI

* SMILES: C1C(CC2=CC=CC=C2C1C3=C(OC4=CC=CC=C4C3=O)O)C5=CC=C(C=C5)C6=CC=CC=C6
Difenoxin (3738)
```
Botcommand: addindex 319682242 Difenoxin
```
```
For index : Difenoxin=319682242
```
* 35607-36-4 -> 35607-36-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Difenoxin not found on commonchemistry - Difenoxin

* No ChemSpiderID (correct: 31620)

* PubChem: 34328

* No InChI

* No SMILES
Difenpiramide (3739)
```
Botcommand: addindex 347607658 Difenpiramide
```
```
For index : Difenpiramide=347607658
```
* 51484-40-3 -> 51484-40-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Difenpiramide not found on commonchemistry - Difenpiramide

* No ChemSpiderID

* PubChem: 100472

* No InChI

* No SMILES
Difetarsone (3740)
```
Botcommand: addindex 306111911 Difetarsone
```
```
For index : Difetarsone=306111911
```
* 3639-19-8 -> 3639-19-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Difetarsone not found on commonchemistry - Difetarsone

* ChemSpiderID: 61506 - UNKNOWN - Retrieved data from ChemSpider

* PubChem: 68199

* No InChI - (ChemSpider: | InChI=InChI=1/C14H18As2N2O6/c19-15(20,21)11-1-5-13(6-2-11)17-9-10-18-14-7-3-12(4-8-14)16(22,23)24/h1-8,17-18H,9-10H2,(H2,19,20,21)(H2,22,23,24) )

* No SMILES - (ChemSpider: | smiles=O=[As](O)(O)c1ccc(cc1)NCCNc2ccc(cc2)[As](=O)(O)O )
Difethialone (3741)
```
Botcommand: addindex 354479923 Difethialone
```
```
For index : Difethialone=354479923
```
* 104653-34-1 -> 104653-34-1 - NOT VERIFIED

* CAS not found on commonchemistry

* Difethialone not found on commonchemistry - Difethialone

* No ChemSpiderID

* PubChem: 91771

* No InChI

* SMILES: C1C(CC2=CC=CC=C2C1C3=C(SC4=CC=CC=C4C3=O)O)C5=CC=C(C=C5)C6=CC=C(C=C6)Br
Diflorasone (3742)
```
Botcommand: addindex 342045654 Diflorasone
```
```
For index : Diflorasone=342045654
```
* 1-13-8 -> 1-13-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Diflorasone found on commonchemistry - Diflorasone
* 2557-49-5 (exact match)
Name in list

All names: Diflorason, diflorasona, [[diflorasone]], Pregna-1,4-diene-3,20-dione, 6,9-difluoro-11,17,21-trihydroxy-16-methyl-, (6Î±,11Î²,16Î²)-, Pregna-1,4-diene-3,20-dione, 6Î±,9-difluoro-11Î²,17,21-trihydroxy-16Î²-methyl-

* No ChemSpiderID

* PubChem: 71414

* No InChI

* No SMILES
Difloxacin (3743)
```
Botcommand: addindex 325869298 Difloxacin
```
```
For index : Difloxacin=325869298
```
* 98106-17-3 -> 98106-17-3 - NOT VERIFIED

* CAS not found on commonchemistry

* Difloxacin not found on commonchemistry - Difloxacin

* No ChemSpiderID

* PubChem: 56206

* No InChI

* No SMILES
Diflucortolone (3744)
```
Botcommand: addindex 354712736 Diflucortolone
```
```
For index : Diflucortolone=354712736
```
* 2607-06-9 -> 2607-06-9 - NOT VERIFIED

* CAS not found on commonchemistry

* Diflucortolone not found on commonchemistry - Diflucortolone

* No ChemSpiderID

* PubChem: 17455

* No InChI

* No SMILES
Difluoropine (3747)
```
Botcommand: addindex 354410777 Difluoropine
```
```
For index : Difluoropine=354410777
```
* 156774-35-5 -> 156774-35-5 - NOT VERIFIED

* CAS not found on commonchemistry

* Difluoropine not found on commonchemistry - Difluoropine

* No ChemSpiderID

* PubChem: 190851

* No InChI

* No SMILES
Difluprednate (3748)
```
Botcommand: addindex 342048424 Difluprednate
```
```
For index : Difluprednate=342048424
```
* 23674-86-4 -> 23674-86-4 - NOT VERIFIED

* CAS not found on commonchemistry

* Difluprednate not found on commonchemistry - Difluprednate

* No ChemSpiderID

* PubChem: 32037

* No InChI

* No SMILES
Digallane (3749)
```
Botcommand: addindex 362688592 Digallane
```
```
For index : Digallane=362688592
```
* 12140-58-8 -> 12140-58-8 - NOT VERIFIED

* CAS not found on commonchemistry

* Digallane not found on commonchemistry - Digallane

* No ChemSpiderID

* No PubChem

* No InChI

* No SMILES